About 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol
2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol (PubChem CID 142653419) has the molecular formula C15H19F2NO2S
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol.
Molecular Properties
| Compound Name | 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol |
| PubChem CID | 142653419 |
| Molecular Formula | C15H19F2NO2S |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol |
| SMILES | OCCNCCCOCCc1c(F)cc2ccsc2c1F |
| InChI | InChI=1S/C15H19F2NO2S/c16-13-10-11-3-9-21-15(11)14(17)12(13)2-8-20-7-1-4-18-5-6-19/h3,9-10,18-19H,1-2,4-8H2 |
| InChIKey | UOJIGBNGAGXVQB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol?
The IUPAC name of 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol (CID 142653419) is 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol.
What is the SMILES notation for 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol?
The canonical SMILES for 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol is OCCNCCCOCCc1c(F)cc2ccsc2c1F.
What is the InChIKey of 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol?
The InChIKey is UOJIGBNGAGXVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2S/c16-13-10-11-3-9-21-15(11)14(17)12(13)2-8-20-7-1-4-18-5-6-19/h3,9-10,18-19H,1-2,4-8H2.
What are the key properties of 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol?
2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol has a molecular weight of 315.38 g/mol, XLogP of 2.71, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(5,7-difluoro-1-benzothiophen-6-yl)ethoxy]propylamino]ethanol is sourced from PubChem (CID 142653419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).