About 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole
3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole (PubChem CID 142653521) has the molecular formula C9H9Cl2N3
and a molecular weight of 230.10 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole.
Molecular Properties
| Compound Name | 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole |
| PubChem CID | 142653521 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole |
| SMILES | ClCN1CC(c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-14-5-9(12-13-14)7-1-3-8(11)4-2-7/h1-4,13H,5-6H2 |
| InChIKey | PWWWXUVRZHXXIU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole?
The IUPAC name of 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole (CID 142653521) is 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole.
What is the SMILES notation for 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole?
The canonical SMILES for 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole is ClCN1CC(c2ccc(Cl)cc2)=NN1.
What is the InChIKey of 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole?
The InChIKey is PWWWXUVRZHXXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3/c10-6-14-5-9(12-13-14)7-1-3-8(11)4-2-7/h1-4,13H,5-6H2.
What are the key properties of 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole?
3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole has a molecular weight of 230.10 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-5-(4-chlorophenyl)-2,4-dihydrotriazole is sourced from PubChem (CID 142653521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).