C26H31N3O4S — CID 142654242
3-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid (PubChem CID 142654242) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid.
| Compound Name | 3-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 142654242 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid |
| SMILES | COCCCCOCC1CCN(c2ccc(-c3nnc(-c4cccc(C(=O)O)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C26H31N3O4S/c1-32-15-2-3-16-33-18-19-11-13-29(14-12-19)23-9-7-20(8-10-23)24-27-28-25(34-24)21-5-4-6-22(17-21)26(30)31/h4-10,17,19H,2-3,11-16,18H2,1H3,(H,30,31) |
| InChIKey | GHJVEFMNVHUVGB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|