C14H28O3Si — CID 142654576
ethyl 5-hydroxy-7-(trimethylsilylmethyl)oct-7-enoate (PubChem CID 142654576) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is ethyl 5-hydroxy-7-(trimethylsilylmethyl)oct-7-enoate.
| Compound Name | ethyl 5-hydroxy-7-(trimethylsilylmethyl)oct-7-enoate |
|---|---|
| PubChem CID | 142654576 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | ethyl 5-hydroxy-7-(trimethylsilylmethyl)oct-7-enoate |
| SMILES | C=C(CC(O)CCCC(=O)OCC)C[Si](C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-6-17-14(16)9-7-8-13(15)10-12(2)11-18(3,4)5/h13,15H,2,6-11H2,1,3-5H3 |
| InChIKey | GTOJMSODUSUKRL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|