C6H8O8 — CID 142655009
(2S)-3,4-dihydroxy-2-(1,1,2,2-tetrahydroxyethyl)-2H-furan-5-one (PubChem CID 142655009) has the molecular formula C6H8O8 and a molecular weight of 208.12 g/mol. Its IUPAC name is (2S)-3,4-dihydroxy-2-(1,1,2,2-tetrahydroxyethyl)-2H-furan-5-one.
| Compound Name | (2S)-3,4-dihydroxy-2-(1,1,2,2-tetrahydroxyethyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 142655009 |
| Molecular Formula | C6H8O8 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | (2S)-3,4-dihydroxy-2-(1,1,2,2-tetrahydroxyethyl)-2H-furan-5-one |
| SMILES | O=C1O[C@H](C(O)(O)C(O)O)C(O)=C1O |
| InChI | InChI=1S/C6H8O8/c7-1-2(8)4(9)14-3(1)6(12,13)5(10)11/h3,5,7-8,10-13H/t3-/m0/s1 |
| InChIKey | RBXYAUPKNXEMRA-VKHMYHEASA-N |
| XLogP | -2.77 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|