C27H35F2NO2 — CID 142655308
10-[2-[(2,6-difluorophenyl)methoxy]-3-methylbutyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol (PubChem CID 142655308) has the molecular formula C27H35F2NO2 and a molecular weight of 443.58 g/mol. Its IUPAC name is 10-[2-[(2,6-difluorophenyl)methoxy]-3-methylbutyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol.
| Compound Name | 10-[2-[(2,6-difluorophenyl)methoxy]-3-methylbutyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 142655308 |
| Molecular Formula | C27H35F2NO2 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 10-[2-[(2,6-difluorophenyl)methoxy]-3-methylbutyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-ol |
| SMILES | CC(C)C(CN1CCC2(C)c3cccc(O)c3CC1C2(C)C)OCc1c(F)cccc1F |
| InChI | InChI=1S/C27H35F2NO2/c1-17(2)24(32-16-19-21(28)9-7-10-22(19)29)15-30-13-12-27(5)20-8-6-11-23(31)18(20)14-25(30)26(27,3)4/h6-11,17,24-25,31H,12-16H2,1-5H3 |
| InChIKey | TVGJJNKFAZQZOU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |