C26H34F2N2O — CID 142655310
10-[2-[(2,6-difluorophenyl)methoxy]butyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine (PubChem CID 142655310) has the molecular formula C26H34F2N2O and a molecular weight of 428.57 g/mol. Its IUPAC name is 10-[2-[(2,6-difluorophenyl)methoxy]butyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine.
| Compound Name | 10-[2-[(2,6-difluorophenyl)methoxy]butyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine |
|---|---|
| PubChem CID | 142655310 |
| Molecular Formula | C26H34F2N2O |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 10-[2-[(2,6-difluorophenyl)methoxy]butyl]-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine |
| SMILES | CCC(CN1CCC2(C)c3cccc(N)c3CC1C2(C)C)OCc1c(F)cccc1F |
| InChI | InChI=1S/C26H34F2N2O/c1-5-17(31-16-19-21(27)9-7-10-22(19)28)15-30-13-12-26(4)20-8-6-11-23(29)18(20)14-24(30)25(26,2)3/h6-11,17,24H,5,12-16,29H2,1-4H3 |
| InChIKey | RXNVZUDNNWYAKF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|