C27H24N6O7S — CID 142655963
4-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-pyridin-4-ylpyrimidin-4-yl]oxybut-2-ynyl carbamate (PubChem CID 142655963) has the molecular formula C27H24N6O7S and a molecular weight of 576.59 g/mol. Its IUPAC name is 4-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-pyridin-4-ylpyrimidin-4-yl]oxybut-2-ynyl carbamate.
| Compound Name | 4-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-pyridin-4-ylpyrimidin-4-yl]oxybut-2-ynyl carbamate |
|---|---|
| PubChem CID | 142655963 |
| Molecular Formula | C27H24N6O7S |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 4-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-pyridin-4-ylpyrimidin-4-yl]oxybut-2-ynyl carbamate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(N)=O |
| InChI | InChI=1S/C27H24N6O7S/c1-18-9-10-22(30-17-18)41(35,36)33-25-23(40-21-8-4-3-7-20(21)37-2)26(38-15-5-6-16-39-27(28)34)32-24(31-25)19-11-13-29-14-12-19/h3-4,7-14,17H,15-16H2,1-2H3,(H2,28,34)(H,31,32,33) |
| InChIKey | VAUXRAFAGWVTNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 177.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|