C20H22N4O3 — CID 142656167
2-(1,3-benzodioxol-5-yl)-N-[5-(diethylamino)-1H-indazol-3-yl]acetamide (PubChem CID 142656167) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[5-(diethylamino)-1H-indazol-3-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[5-(diethylamino)-1H-indazol-3-yl]acetamide |
|---|---|
| PubChem CID | 142656167 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[5-(diethylamino)-1H-indazol-3-yl]acetamide |
| SMILES | CCN(CC)c1ccc2[nH]nc(NC(=O)Cc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C20H22N4O3/c1-3-24(4-2)14-6-7-16-15(11-14)20(23-22-16)21-19(25)10-13-5-8-17-18(9-13)27-12-26-17/h5-9,11H,3-4,10,12H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | XSUCAGANYGYQPG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |