C11H14N2OS — CID 142657101
5-(2-methoxyphenyl)sulfanyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 142657101) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)sulfanyl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 5-(2-methoxyphenyl)sulfanyl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 142657101 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-(2-methoxyphenyl)sulfanyl-1,4,5,6-tetrahydropyrimidine |
| SMILES | COc1ccccc1SC1CN=CNC1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-10-4-2-3-5-11(10)15-9-6-12-8-13-7-9/h2-5,8-9H,6-7H2,1H3,(H,12,13) |
| InChIKey | GAJUFKSMYGHPCE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |