C13H16N2O — CID 14265734
2-(1,3-diazepan-2-ylidene)-1-phenylethanone (PubChem CID 14265734) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(1,3-diazepan-2-ylidene)-1-phenylethanone.
| Compound Name | 2-(1,3-diazepan-2-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 14265734 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-(1,3-diazepan-2-ylidene)-1-phenylethanone |
| SMILES | O=C(C=C1NCCCCN1)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c16-12(11-6-2-1-3-7-11)10-13-14-8-4-5-9-15-13/h1-3,6-7,10,14-15H,4-5,8-9H2 |
| InChIKey | MZOVYEUHNGSUTF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|