C27H30N2O6S2 — CID 142658306
2-[7-[5-(4-ethylphenyl)thiophen-2-yl]-4-(2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide (PubChem CID 142658306) has the molecular formula C27H30N2O6S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 2-[7-[5-(4-ethylphenyl)thiophen-2-yl]-4-(2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[7-[5-(4-ethylphenyl)thiophen-2-yl]-4-(2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 142658306 |
| Molecular Formula | C27H30N2O6S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-[7-[5-(4-ethylphenyl)thiophen-2-yl]-4-(2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
| SMILES | CCc1ccc(-c2ccc(C3(CC(=O)NO)CCN(C(=O)c4ccccc4OC)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C27H30N2O6S2/c1-3-19-8-10-20(11-9-19)23-12-13-24(36-23)27(18-25(30)28-32)14-15-29(16-17-37(27,33)34)26(31)21-6-4-5-7-22(21)35-2/h4-13,32H,3,14-18H2,1-2H3,(H,28,30) |
| InChIKey | YENIYLGFLVNHLO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|