C15H19ClN2O2 — CID 142659872
3-(4-methoxyphenoxy)-3-pyridin-4-ylpropan-1-amine;hydrochloride (PubChem CID 142659872) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 3-(4-methoxyphenoxy)-3-pyridin-4-ylpropan-1-amine;hydrochloride.
| Compound Name | 3-(4-methoxyphenoxy)-3-pyridin-4-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 142659872 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(4-methoxyphenoxy)-3-pyridin-4-ylpropan-1-amine;hydrochloride |
| SMILES | COc1ccc(OC(CCN)c2ccncc2)cc1.Cl |
| InChI | InChI=1S/C15H18N2O2.ClH/c1-18-13-2-4-14(5-3-13)19-15(6-9-16)12-7-10-17-11-8-12;/h2-5,7-8,10-11,15H,6,9,16H2,1H3;1H |
| InChIKey | SLVIPVWBJYTQAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |