C13H17FO6 — CID 142660532
(2R,3R,4S,5S)-5-fluoro-7-phenylhept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 142660532) has the molecular formula C13H17FO6 and a molecular weight of 288.27 g/mol. Its IUPAC name is (2R,3R,4S,5S)-5-fluoro-7-phenylhept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5S)-5-fluoro-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 142660532 |
| Molecular Formula | C13H17FO6 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2R,3R,4S,5S)-5-fluoro-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@](O)(F)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C13H17FO6/c14-13(20,12(19)11(18)9(16)7-15)10(17)6-8-4-2-1-3-5-8/h1-6,9,11-12,15-20H,7H2/t9-,11-,12+,13+/m1/s1 |
| InChIKey | QUXMJDFQYRLRFU-XEZLXBQYSA-N |
| XLogP | -0.68 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|