About (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate
(2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 142660849) has the molecular formula C28H38O4
and a molecular weight of 438.61 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| PubChem CID | 142660849 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | C=C(C(=O)OC)C12C3CCC(C3)C1C1CC2CC1C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C28H38O4/c1-14(25(29)31-3)28-18-5-4-17(11-18)24(28)22-12-21(28)13-23(22)26(30)32-27(2)19-7-15-6-16(9-19)10-20(27)8-15/h15-24H,1,4-13H2,2-3H3 |
| InChIKey | CFJKVRFSCGWAMT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate?
The IUPAC name of (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (CID 142660849) is (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
What is the SMILES notation for (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate?
The canonical SMILES for (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate is C=C(C(=O)OC)C12C3CCC(C3)C1C1CC2CC1C(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate?
The InChIKey is CFJKVRFSCGWAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O4/c1-14(25(29)31-3)28-18-5-4-17(11-18)24(28)22-12-21(28)13-23(22)26(30)32-27(2)19-7-15-6-16(9-19)10-20(27)8-15/h15-24H,1,4-13H2,2-3H3.
What are the key properties of (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate?
(2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate has a molecular weight of 438.61 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 7-(3-methoxy-3-oxoprop-1-en-2-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate is sourced from PubChem (CID 142660849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).