C10H14N2O2 — CID 142660929
2-(2-hydroxyethyl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 142660929) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-(2-hydroxyethyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 142660929 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(2-hydroxyethyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1C2CC=CCC2C=NN1CCO |
| InChI | InChI=1S/C10H14N2O2/c13-6-5-12-10(14)9-4-2-1-3-8(9)7-11-12/h1-2,7-9,13H,3-6H2 |
| InChIKey | HVSMUJPQFJCHMX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|