C18H13NO3 — CID 142660972
N-(7,8-dioxonaphthalen-1-yl)-N-methylbenzamide (PubChem CID 142660972) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-(7,8-dioxonaphthalen-1-yl)-N-methylbenzamide.
| Compound Name | N-(7,8-dioxonaphthalen-1-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 142660972 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(7,8-dioxonaphthalen-1-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)c1cccc2c1C(=O)C(=O)C=C2 |
| InChI | InChI=1S/C18H13NO3/c1-19(18(22)13-6-3-2-4-7-13)14-9-5-8-12-10-11-15(20)17(21)16(12)14/h2-11H,1H3 |
| InChIKey | JNXNASBSQLTVBD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|