C26H17NO2 — CID 142661491
11-(4-anilinophenyl)tricyclo[8.3.1.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-2,9-dione (PubChem CID 142661491) has the molecular formula C26H17NO2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 11-(4-anilinophenyl)tricyclo[8.3.1.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-2,9-dione.
| Compound Name | 11-(4-anilinophenyl)tricyclo[8.3.1.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-2,9-dione |
|---|---|
| PubChem CID | 142661491 |
| Molecular Formula | C26H17NO2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 11-(4-anilinophenyl)tricyclo[8.3.1.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-2,9-dione |
| SMILES | O=C1c2ccc(-c3ccc(Nc4ccccc4)cc3)c(c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H17NO2/c28-25-18-12-15-21(24(16-18)26(29)23-9-5-4-8-22(23)25)17-10-13-20(14-11-17)27-19-6-2-1-3-7-19/h1-16,27H |
| InChIKey | FZSFNDKCSPSFIQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |