About cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone
cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone (PubChem CID 142661553) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone |
| PubChem CID | 142661553 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone |
| SMILES | NC1CN(C(=O)C2=CCCCC2)CC1N |
| InChI | InChI=1S/C11H19N3O/c12-9-6-14(7-10(9)13)11(15)8-4-2-1-3-5-8/h4,9-10H,1-3,5-7,12-13H2 |
| InChIKey | BYODTDNEAQZZLW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone?
The IUPAC name of cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone (CID 142661553) is cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone.
What is the SMILES notation for cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone?
The canonical SMILES for cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone is NC1CN(C(=O)C2=CCCCC2)CC1N.
What is the InChIKey of cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone?
The InChIKey is BYODTDNEAQZZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c12-9-6-14(7-10(9)13)11(15)8-4-2-1-3-5-8/h4,9-10H,1-3,5-7,12-13H2.
What are the key properties of cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone?
cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone has a molecular weight of 209.29 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-yl-(3,4-diaminopyrrolidin-1-yl)methanone is sourced from PubChem (CID 142661553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).