About 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide
6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide (PubChem CID 142662120) has the molecular formula C15H8Cl2F4N4O2S
and a molecular weight of 455.22 g/mol. Its IUPAC name is 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
| PubChem CID | 142662120 |
| Molecular Formula | C15H8Cl2F4N4O2S |
| Molecular Weight | 455.22 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2cc(F)c(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C15H8Cl2F4N4O2S/c16-9-4-10(17)11(18)3-8(9)12-5-13(15(19,20)21)24-25(12)14-2-1-7(6-23-14)28(22,26)27/h1-6H,(H2,22,26,27) |
| InChIKey | HCSIZCWSACLSNT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide?
The IUPAC name of 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide (CID 142662120) is 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide.
What is the SMILES notation for 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide?
The canonical SMILES for 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide is NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2cc(F)c(Cl)cc2Cl)nc1.
What is the InChIKey of 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide?
The InChIKey is HCSIZCWSACLSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2F4N4O2S/c16-9-4-10(17)11(18)3-8(9)12-5-13(15(19,20)21)24-25(12)14-2-1-7(6-23-14)28(22,26)27/h1-6H,(H2,22,26,27).
What are the key properties of 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide?
6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide has a molecular weight of 455.22 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(2,4-dichloro-5-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 142662120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).