About 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile
5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile (PubChem CID 142662650) has the molecular formula C5H5N3O2
and a molecular weight of 139.11 g/mol. Its IUPAC name is 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile |
| PubChem CID | 142662650 |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(CON)on1 |
| InChI | InChI=1S/C5H5N3O2/c6-2-4-1-5(3-9-7)10-8-4/h1H,3,7H2 |
| InChIKey | SQUQQVKBQFLBHG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile (CID 142662650) is 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile is N#Cc1cc(CON)on1.
What is the InChIKey of 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile?
The InChIKey is SQUQQVKBQFLBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2/c6-2-4-1-5(3-9-7)10-8-4/h1H,3,7H2.
What are the key properties of 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile?
5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile has a molecular weight of 139.11 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminooxymethyl)-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 142662650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).