About (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid
(Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid (PubChem CID 142663150) has the molecular formula C8H15FN2O2
and a molecular weight of 190.22 g/mol. Its IUPAC name is (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid.
Molecular Properties
| Compound Name | (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid |
| PubChem CID | 142663150 |
| Molecular Formula | C8H15FN2O2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid |
| SMILES | CC(CC/C(F)=C/C(N)N)C(=O)O |
| InChI | InChI=1S/C8H15FN2O2/c1-5(8(12)13)2-3-6(9)4-7(10)11/h4-5,7H,2-3,10-11H2,1H3,(H,12,13)/b6-4- |
| InChIKey | BCFWFUDPZJFCNS-XQRVVYSFSA-N |
| XLogP | 0.58 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid?
The IUPAC name of (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid (CID 142663150) is (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid.
What is the SMILES notation for (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid?
The canonical SMILES for (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid is CC(CC/C(F)=C/C(N)N)C(=O)O.
What is the InChIKey of (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid?
The InChIKey is BCFWFUDPZJFCNS-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H15FN2O2/c1-5(8(12)13)2-3-6(9)4-7(10)11/h4-5,7H,2-3,10-11H2,1H3,(H,12,13)/b6-4-.
What are the key properties of (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid?
(Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid has a molecular weight of 190.22 g/mol, XLogP of 0.58, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7,7-diamino-5-fluoro-2-methylhept-5-enoic acid is sourced from PubChem (CID 142663150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).