About (2S)-2,3-bis(hydroxyamino)propanamide
(2S)-2,3-bis(hydroxyamino)propanamide (PubChem CID 142663398) has the molecular formula C3H9N3O3
and a molecular weight of 135.12 g/mol. Its IUPAC name is (2S)-2,3-bis(hydroxyamino)propanamide.
Molecular Properties
| Compound Name | (2S)-2,3-bis(hydroxyamino)propanamide |
| PubChem CID | 142663398 |
| Molecular Formula | C3H9N3O3 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | (2S)-2,3-bis(hydroxyamino)propanamide |
| SMILES | NC(=O)[C@H](CNO)NO |
| InChI | InChI=1S/C3H9N3O3/c4-3(7)2(6-9)1-5-8/h2,5-6,8-9H,1H2,(H2,4,7)/t2-/m0/s1 |
| InChIKey | LPDLAECTMGXAFL-REOHCLBHSA-N |
| XLogP | -2.20 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,3-bis(hydroxyamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-bis(hydroxyamino)propanamide?
The IUPAC name of (2S)-2,3-bis(hydroxyamino)propanamide (CID 142663398) is (2S)-2,3-bis(hydroxyamino)propanamide.
What is the SMILES notation for (2S)-2,3-bis(hydroxyamino)propanamide?
The canonical SMILES for (2S)-2,3-bis(hydroxyamino)propanamide is NC(=O)[C@H](CNO)NO.
What is the InChIKey of (2S)-2,3-bis(hydroxyamino)propanamide?
The InChIKey is LPDLAECTMGXAFL-REOHCLBHSA-N. The full InChI is InChI=1S/C3H9N3O3/c4-3(7)2(6-9)1-5-8/h2,5-6,8-9H,1H2,(H2,4,7)/t2-/m0/s1.
What are the key properties of (2S)-2,3-bis(hydroxyamino)propanamide?
(2S)-2,3-bis(hydroxyamino)propanamide has a molecular weight of 135.12 g/mol, XLogP of -2.20, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-bis(hydroxyamino)propanamide is sourced from PubChem (CID 142663398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).