About oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate
oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate (PubChem CID 142664594) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate |
| PubChem CID | 142664594 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate |
| SMILES | C=CC(=O)O/C(C=C)=C(\C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C12H14O5/c1-4-10(17-11(13)5-2)8(3)12(14)16-7-9-6-15-9/h4-5,9H,1-2,6-7H2,3H3/b10-8+ |
| InChIKey | RVXRHOAMNCHWHR-CSKARUKUSA-N |
| XLogP | 1.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate?
The IUPAC name of oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate (CID 142664594) is oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate.
What is the SMILES notation for oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate?
The canonical SMILES for oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate is C=CC(=O)O/C(C=C)=C(\C)C(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate?
The InChIKey is RVXRHOAMNCHWHR-CSKARUKUSA-N. The full InChI is InChI=1S/C12H14O5/c1-4-10(17-11(13)5-2)8(3)12(14)16-7-9-6-15-9/h4-5,9H,1-2,6-7H2,3H3/b10-8+.
What are the key properties of oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate?
oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate has a molecular weight of 238.24 g/mol, XLogP of 1.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl (2E)-2-methyl-3-prop-2-enoyloxypenta-2,4-dienoate is sourced from PubChem (CID 142664594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).