C6F13NO — CID 142664628
2,2,3,3,5,6,6-heptafluoro-4,5-bis(trifluoromethyl)morpholine (PubChem CID 142664628) has the molecular formula C6F13NO and a molecular weight of 349.05 g/mol. Its IUPAC name is 2,2,3,3,5,6,6-heptafluoro-4,5-bis(trifluoromethyl)morpholine.
| Compound Name | 2,2,3,3,5,6,6-heptafluoro-4,5-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 142664628 |
| Molecular Formula | C6F13NO |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 2,2,3,3,5,6,6-heptafluoro-4,5-bis(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C6F13NO/c7-1(2(8,9)10)4(13,14)21-5(15,16)3(11,12)20(1)6(17,18)19 |
| InChIKey | QYEHDOQBMZPWFU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|