C18H31NO5 — CID 142665682
2-[4-[(2R)-2-[(E)-8-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid (PubChem CID 142665682) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[(E)-8-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[(E)-8-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
|---|---|
| PubChem CID | 142665682 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-[4-[(2R)-2-[(E)-8-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
| SMILES | O=C(O)COCCCCN1C(=O)CC[C@@H]1/C=C/CCCCCCO |
| InChI | InChI=1S/C18H31NO5/c20-13-7-4-2-1-3-5-9-16-10-11-17(21)19(16)12-6-8-14-24-15-18(22)23/h5,9,16,20H,1-4,6-8,10-15H2,(H,22,23)/b9-5+/t16-/m0/s1 |
| InChIKey | GGZBREAUOYARGV-RDTXFTJFSA-N |
| XLogP | 2.36 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|