C32H36N4O4S — CID 142665849
prop-2-enyl (2S,4S)-2-[(2Z)-2-(dimethylcarbamoylamino)oxyiminoethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 142665849) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[(2Z)-2-(dimethylcarbamoylamino)oxyiminoethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[(2Z)-2-(dimethylcarbamoylamino)oxyiminoethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142665849 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[(2Z)-2-(dimethylcarbamoylamino)oxyiminoethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H]1C/C=N\ONC(=O)N(C)C |
| InChI | InChI=1S/C32H36N4O4S/c1-4-22-39-31(38)36-24-29(23-28(36)20-21-33-40-34-30(37)35(2)3)41-32(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h4-19,21,28-29H,1,20,22-24H2,2-3H3,(H,34,37)/b33-21-/t28-,29-/m0/s1 |
| InChIKey | HCNFJGBHYINCEU-VBKNDQNWSA-N |
| XLogP | 6.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|