C19H19NO7 — CID 142666118
4,10,15-trioxatricyclo[10.3.0.03,5]pentadeca-1,3(5),6,8,11,13-hexaen-6-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 142666118) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is 4,10,15-trioxatricyclo[10.3.0.03,5]pentadeca-1,3(5),6,8,11,13-hexaen-6-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 4,10,15-trioxatricyclo[10.3.0.03,5]pentadeca-1,3(5),6,8,11,13-hexaen-6-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 142666118 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4,10,15-trioxatricyclo[10.3.0.03,5]pentadeca-1,3(5),6,8,11,13-hexaen-6-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Oc1cccocc2ccoc2cc2oc1=2 |
| InChI | InChI=1S/C19H19NO7/c1-19(2,3)27-18(22)20-10-16(21)25-13-5-4-7-23-11-12-6-8-24-14(12)9-15-17(13)26-15/h4-9,11H,10H2,1-3H3,(H,20,22)/b7-4+,12-11?,13-5+,14-9- |
| InChIKey | ZGDYJKPSKBRGST-AESYRUICSA-N |
| XLogP | 3.90 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |