About 2-chloro-2-ethylindole
2-chloro-2-ethylindole (PubChem CID 142666503) has the molecular formula C10H10ClN
and a molecular weight of 179.65 g/mol. Its IUPAC name is 2-chloro-2-ethylindole.
Molecular Properties
| Compound Name | 2-chloro-2-ethylindole |
| PubChem CID | 142666503 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 2-chloro-2-ethylindole |
| SMILES | CCC1(Cl)C=c2ccccc2=N1 |
| InChI | InChI=1S/C10H10ClN/c1-2-10(11)7-8-5-3-4-6-9(8)12-10/h3-7H,2H2,1H3 |
| InChIKey | NKLLOMMRNSCNLF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-ethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-ethylindole?
The IUPAC name of 2-chloro-2-ethylindole (CID 142666503) is 2-chloro-2-ethylindole.
What is the SMILES notation for 2-chloro-2-ethylindole?
The canonical SMILES for 2-chloro-2-ethylindole is CCC1(Cl)C=c2ccccc2=N1.
What is the InChIKey of 2-chloro-2-ethylindole?
The InChIKey is NKLLOMMRNSCNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN/c1-2-10(11)7-8-5-3-4-6-9(8)12-10/h3-7H,2H2,1H3.
What are the key properties of 2-chloro-2-ethylindole?
2-chloro-2-ethylindole has a molecular weight of 179.65 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-ethylindole is sourced from PubChem (CID 142666503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).