C22H25N7O4 — CID 142666519
3-[5-(6-methoxy-3-pyridinyl)-2H-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide (PubChem CID 142666519) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-[5-(6-methoxy-3-pyridinyl)-2H-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide.
| Compound Name | 3-[5-(6-methoxy-3-pyridinyl)-2H-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 142666519 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 3-[5-(6-methoxy-3-pyridinyl)-2H-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]propanamide |
| SMILES | COc1ccc(C2(CCC(=O)NCCCNc3n[nH]c(=O)c4ccccc34)N=CNO2)cn1 |
| InChI | InChI=1S/C22H25N7O4/c1-32-19-8-7-15(13-25-19)22(26-14-27-33-22)10-9-18(30)23-11-4-12-24-20-16-5-2-3-6-17(16)21(31)29-28-20/h2-3,5-8,13-14H,4,9-12H2,1H3,(H,23,30)(H,24,28)(H,26,27)(H,29,31) |
| InChIKey | OOHHXSDCAAGOKO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|