C12H20N2OS — CID 142666563
N-[(1S)-cyclohex-2-en-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 142666563) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[(1S)-cyclohex-2-en-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[(1S)-cyclohex-2-en-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142666563 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[(1S)-cyclohex-2-en-1-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SCNC1C(=O)N[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C12H20N2OS/c1-12(2)10(13-8-16-12)11(15)14-9-6-4-3-5-7-9/h4,6,9-10,13H,3,5,7-8H2,1-2H3,(H,14,15)/t9-,10?/m1/s1 |
| InChIKey | YVSMYMWIQOMXGO-YHMJZVADSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|