About (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea
(6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea (PubChem CID 142666844) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea.
Molecular Properties
| Compound Name | (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea |
| PubChem CID | 142666844 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea |
| SMILES | NC(=O)NCC1C=CC=CC1=S |
| InChI | InChI=1S/C8H10N2OS/c9-8(11)10-5-6-3-1-2-4-7(6)12/h1-4,6H,5H2,(H3,9,10,11) |
| InChIKey | QQFFOJFQJIFXKM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea?
The IUPAC name of (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea (CID 142666844) is (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea.
What is the SMILES notation for (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea?
The canonical SMILES for (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea is NC(=O)NCC1C=CC=CC1=S.
What is the InChIKey of (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea?
The InChIKey is QQFFOJFQJIFXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c9-8(11)10-5-6-3-1-2-4-7(6)12/h1-4,6H,5H2,(H3,9,10,11).
What are the key properties of (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea?
(6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea has a molecular weight of 182.25 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-sulfanylidenecyclohexa-2,4-dien-1-yl)methylurea is sourced from PubChem (CID 142666844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).