C31H39Cl2FN4O5S — CID 142667106
(2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride (PubChem CID 142667106) has the molecular formula C31H39Cl2FN4O5S and a molecular weight of 669.65 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride.
| Compound Name | (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 142667106 |
| Molecular Formula | C31H39Cl2FN4O5S |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride |
| SMILES | COc1ccc2c(c1)CC[C@H](NC(=O)[C@H](CCCCNS(=O)(=O)c1ccccc1F)NC(C)=O)[C@@H]2Cc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C31H37FN4O5S.2ClH/c1-21(37)35-29(10-5-6-17-34-42(39,40)30-11-4-3-9-27(30)32)31(38)36-28-15-12-23-19-24(41-2)13-14-25(23)26(28)18-22-8-7-16-33-20-22;;/h3-4,7-9,11,13-14,16,19-20,26,28-29,34H,5-6,10,12,15,17-18H2,1-2H3,(H,35,37)(H,36,38);2*1H/t26-,28+,29+;;/m1../s1 |
| InChIKey | JXTMTJTXSNGPDZ-YGPDPXTASA-N |
| XLogP | 4.48 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|