C29H37Cl2FN4O4S — CID 142667108
(2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride (PubChem CID 142667108) has the molecular formula C29H37Cl2FN4O4S and a molecular weight of 627.61 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 142667108 |
| Molecular Formula | C29H37Cl2FN4O4S |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1R,2S)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide;dihydrochloride |
| SMILES | COc1ccc2c(c1)CC[C@H](NC(=O)[C@@H](N)CCCCNS(=O)(=O)c1ccccc1F)[C@@H]2Cc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C29H35FN4O4S.2ClH/c1-38-22-12-13-23-21(18-22)11-14-27(24(23)17-20-7-6-15-32-19-20)34-29(35)26(31)9-4-5-16-33-39(36,37)28-10-3-2-8-25(28)30;;/h2-3,6-8,10,12-13,15,18-19,24,26-27,33H,4-5,9,11,14,16-17,31H2,1H3,(H,34,35);2*1H/t24-,26+,27+;;/m1../s1 |
| InChIKey | KOIQVUKALTYFOE-YCJRRETCSA-N |
| XLogP | 4.31 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|