C17H29NO2 — CID 142667199
butyl 3-pentyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 142667199) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is butyl 3-pentyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | butyl 3-pentyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 142667199 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | butyl 3-pentyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CCCCCC1=CC2CCC(C1)N2C(=O)OCCCC |
| InChI | InChI=1S/C17H29NO2/c1-3-5-7-8-14-12-15-9-10-16(13-14)18(15)17(19)20-11-6-4-2/h12,15-16H,3-11,13H2,1-2H3 |
| InChIKey | BJONLDTZYNBCKS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|