About 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol
1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol (PubChem CID 142667481) has the molecular formula C23H43NO
and a molecular weight of 349.60 g/mol. Its IUPAC name is 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol |
| PubChem CID | 142667481 |
| Molecular Formula | C23H43NO |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 349.33 |
| IUPAC Name | 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C23H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-24-21-18-23(25)19-22-24/h6-7,9-10,23,25H,2-5,8,11-22H2,1H3/b7-6+,10-9+ |
| InChIKey | OTYAOFFXYMEZOY-AVQMFFATSA-N |
| XLogP | 6.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol?
The IUPAC name of 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol (CID 142667481) is 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol.
What is the SMILES notation for 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol?
The canonical SMILES for 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol is CCCCC/C=C/C/C=C/CCCCCCCCN1CCC(O)CC1.
What is the InChIKey of 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol?
The InChIKey is OTYAOFFXYMEZOY-AVQMFFATSA-N. The full InChI is InChI=1S/C23H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-24-21-18-23(25)19-22-24/h6-7,9-10,23,25H,2-5,8,11-22H2,1H3/b7-6+,10-9+.
What are the key properties of 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol?
1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol has a molecular weight of 349.60 g/mol, XLogP of 6.26, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(9E,12E)-octadeca-9,12-dienyl]piperidin-4-ol is sourced from PubChem (CID 142667481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).