About 1-(octadeca-9,12-dienylamino)propan-2-ol
1-(octadeca-9,12-dienylamino)propan-2-ol (PubChem CID 142667488) has the molecular formula C21H41NO
and a molecular weight of 323.57 g/mol. Its IUPAC name is 1-(octadeca-9,12-dienylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(octadeca-9,12-dienylamino)propan-2-ol |
| PubChem CID | 142667488 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | 1-(octadeca-9,12-dienylamino)propan-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCCNCC(C)O |
| InChI | InChI=1S/C21H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-21(2)23/h7-8,10-11,21-23H,3-6,9,12-20H2,1-2H3 |
| InChIKey | LBSRWLSRMVIRSA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(octadeca-9,12-dienylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(octadeca-9,12-dienylamino)propan-2-ol?
The IUPAC name of 1-(octadeca-9,12-dienylamino)propan-2-ol (CID 142667488) is 1-(octadeca-9,12-dienylamino)propan-2-ol.
What is the SMILES notation for 1-(octadeca-9,12-dienylamino)propan-2-ol?
The canonical SMILES for 1-(octadeca-9,12-dienylamino)propan-2-ol is CCCCCC=CCC=CCCCCCCCCNCC(C)O.
What is the InChIKey of 1-(octadeca-9,12-dienylamino)propan-2-ol?
The InChIKey is LBSRWLSRMVIRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-21(2)23/h7-8,10-11,21-23H,3-6,9,12-20H2,1-2H3.
What are the key properties of 1-(octadeca-9,12-dienylamino)propan-2-ol?
1-(octadeca-9,12-dienylamino)propan-2-ol has a molecular weight of 323.57 g/mol, XLogP of 5.77, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(octadeca-9,12-dienylamino)propan-2-ol is sourced from PubChem (CID 142667488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).