C8H12N2O6 — CID 142668448
acetyl 2-[(2-aminoacetyl)amino]-2-hydroxy-3-oxobutanoate (PubChem CID 142668448) has the molecular formula C8H12N2O6 and a molecular weight of 232.19 g/mol. Its IUPAC name is acetyl 2-[(2-aminoacetyl)amino]-2-hydroxy-3-oxobutanoate.
| Compound Name | acetyl 2-[(2-aminoacetyl)amino]-2-hydroxy-3-oxobutanoate |
|---|---|
| PubChem CID | 142668448 |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | acetyl 2-[(2-aminoacetyl)amino]-2-hydroxy-3-oxobutanoate |
| SMILES | CC(=O)OC(=O)C(O)(NC(=O)CN)C(C)=O |
| InChI | InChI=1S/C8H12N2O6/c1-4(11)8(15,10-6(13)3-9)7(14)16-5(2)12/h15H,3,9H2,1-2H3,(H,10,13) |
| InChIKey | VFPVQBGOFXZJAN-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|