C14H14N2O2S3 — CID 142668609
S-[1-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]azetidin-3-yl] ethanethioate (PubChem CID 142668609) has the molecular formula C14H14N2O2S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is S-[1-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]azetidin-3-yl] ethanethioate.
| Compound Name | S-[1-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 142668609 |
| Molecular Formula | C14H14N2O2S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | S-[1-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]azetidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CN(C(=O)CSc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C14H14N2O2S3/c1-9(17)20-10-6-16(7-10)13(18)8-19-14-15-11-4-2-3-5-12(11)21-14/h2-5,10H,6-8H2,1H3 |
| InChIKey | YSWZINYTDHJYFM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|