C26H35FN6O — CID 142668738
6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 142668738) has the molecular formula C26H35FN6O and a molecular weight of 466.61 g/mol. Its IUPAC name is 6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142668738 |
| Molecular Formula | C26H35FN6O |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(N3CCCC4CCCC=C43)n2)cc1F |
| InChI | InChI=1S/C26H35FN6O/c1-34-23-15-14-20(17-21(23)27)29-25-30-24(28-19-11-4-2-3-5-12-19)31-26(32-25)33-16-8-10-18-9-6-7-13-22(18)33/h13-15,17-19H,2-12,16H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | KKTQQNMXDWCXOI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |