C13H6F6O2 — CID 142668987
3,5-bis(trifluoromethyl)naphthalene-1-carboxylic acid (PubChem CID 142668987) has the molecular formula C13H6F6O2 and a molecular weight of 308.18 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)naphthalene-1-carboxylic acid.
| Compound Name | 3,5-bis(trifluoromethyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 142668987 |
| Molecular Formula | C13H6F6O2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3,5-bis(trifluoromethyl)naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C13H6F6O2/c14-12(15,16)6-4-8-7(9(5-6)11(20)21)2-1-3-10(8)13(17,18)19/h1-5H,(H,20,21) |
| InChIKey | QJWJFFGZXTXZCV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |