About 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide
2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide (PubChem CID 142669437) has the molecular formula C11H23NO2S
and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide |
| PubChem CID | 142669437 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide |
| SMILES | C[C@@H]1CCCC[C@H]1NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-9-7-5-6-8-10(9)12-15(13,14)11(2,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | NSEGEIRRHLAEJT-NXEZZACHSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide?
The IUPAC name of 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide (CID 142669437) is 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide.
What is the SMILES notation for 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide?
The canonical SMILES for 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide is C[C@@H]1CCCC[C@H]1NS(=O)(=O)C(C)(C)C.
What is the InChIKey of 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide?
The InChIKey is NSEGEIRRHLAEJT-NXEZZACHSA-N. The full InChI is InChI=1S/C11H23NO2S/c1-9-7-5-6-8-10(9)12-15(13,14)11(2,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10-/m1/s1.
What are the key properties of 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide?
2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide has a molecular weight of 233.38 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(1R,2R)-2-methylcyclohexyl]propane-2-sulfonamide is sourced from PubChem (CID 142669437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).