C39H47ClN4O4 — CID 142670121
(1R,5S)-3-(5-amino-5-oxopentanoyl)-N-[3-(2-chlorophenyl)propyl]-7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 142670121) has the molecular formula C39H47ClN4O4 and a molecular weight of 671.28 g/mol. Its IUPAC name is (1R,5S)-3-(5-amino-5-oxopentanoyl)-N-[3-(2-chlorophenyl)propyl]-7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (1R,5S)-3-(5-amino-5-oxopentanoyl)-N-[3-(2-chlorophenyl)propyl]-7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 142670121 |
| Molecular Formula | C39H47ClN4O4 |
| Molecular Weight | 671.28 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | (1R,5S)-3-(5-amino-5-oxopentanoyl)-N-[3-(2-chlorophenyl)propyl]-7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | Cc1cc(C)c(C)c(OCCc2ccc(C3=C(C(=O)NCCCc4ccccc4Cl)[C@H]4CN(C(=O)CCCC(N)=O)C[C@@H](C3)N4)cc2)c1 |
| InChI | InChI=1S/C39H47ClN4O4/c1-25-20-26(2)27(3)35(21-25)48-19-17-28-13-15-29(16-14-28)32-22-31-23-44(37(46)12-6-11-36(41)45)24-34(43-31)38(32)39(47)42-18-7-9-30-8-4-5-10-33(30)40/h4-5,8,10,13-16,20-21,31,34,43H,6-7,9,11-12,17-19,22-24H2,1-3H3,(H2,41,45)(H,42,47)/t31-,34-/m1/s1 |
| InChIKey | GZQSTEXKAYHDLW-QIKUIUABSA-N |
| XLogP | 5.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.28 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|