C17H14ClN3O2 — CID 142671430
6-chloro-7-(4-propylanilino)phthalazine-5,8-dione (PubChem CID 142671430) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 6-chloro-7-(4-propylanilino)phthalazine-5,8-dione.
| Compound Name | 6-chloro-7-(4-propylanilino)phthalazine-5,8-dione |
|---|---|
| PubChem CID | 142671430 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 6-chloro-7-(4-propylanilino)phthalazine-5,8-dione |
| SMILES | CCCc1ccc(NC2=C(Cl)C(=O)c3cnncc3C2=O)cc1 |
| InChI | InChI=1S/C17H14ClN3O2/c1-2-3-10-4-6-11(7-5-10)21-15-14(18)16(22)12-8-19-20-9-13(12)17(15)23/h4-9,21H,2-3H2,1H3 |
| InChIKey | XSVHPTFRHBFOAA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|