C12H12FN3O2 — CID 142672061
3-amino-1-cyclopropyl-6-fluoro-8-methylquinazoline-2,4-dione (PubChem CID 142672061) has the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-amino-1-cyclopropyl-6-fluoro-8-methylquinazoline-2,4-dione.
| Compound Name | 3-amino-1-cyclopropyl-6-fluoro-8-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 142672061 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-amino-1-cyclopropyl-6-fluoro-8-methylquinazoline-2,4-dione |
| SMILES | Cc1cc(F)cc2c(=O)n(N)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C12H12FN3O2/c1-6-4-7(13)5-9-10(6)15(8-2-3-8)12(18)16(14)11(9)17/h4-5,8H,2-3,14H2,1H3 |
| InChIKey | HEWHMMYQWREOSK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |