C8H9N5O2 — CID 142672755
6-nitro-1-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 142672755) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 6-nitro-1-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-nitro-1-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142672755 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-nitro-1-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1(c2ncn[nH]2)C=CC=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N5O2/c9-8(7-10-5-11-12-7)4-2-1-3-6(8)13(14)15/h1-6H,9H2,(H,10,11,12) |
| InChIKey | QHGPVHNFFXGPLO-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|