C30H41F2N3O5S — CID 142673205
(2R)-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-heptan-4-ylsulfonyl-2-isocyanatopropanamide (PubChem CID 142673205) has the molecular formula C30H41F2N3O5S and a molecular weight of 593.74 g/mol. Its IUPAC name is (2R)-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-heptan-4-ylsulfonyl-2-isocyanatopropanamide.
| Compound Name | (2R)-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-heptan-4-ylsulfonyl-2-isocyanatopropanamide |
|---|---|
| PubChem CID | 142673205 |
| Molecular Formula | C30H41F2N3O5S |
| Molecular Weight | 593.74 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | (2R)-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-heptan-4-ylsulfonyl-2-isocyanatopropanamide |
| SMILES | CCCC(CCC)S(=O)(=O)C[C@H](N=C=O)C(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccc(CC)c1 |
| InChI | InChI=1S/C30H41F2N3O5S/c1-4-8-26(9-5-2)41(39,40)19-28(34-20-36)30(38)35-27(15-23-13-24(31)16-25(32)14-23)29(37)18-33-17-22-11-7-10-21(6-3)12-22/h7,10-14,16,26-29,33,37H,4-6,8-9,15,17-19H2,1-3H3,(H,35,38)/t27-,28-,29+/m0/s1 |
| InChIKey | CKFZNCVKQAQZLJ-YTCPBCGMSA-N |
| XLogP | 3.79 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|