C19H25NO3 — CID 142673580
methyl N-ethyl-N-[3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate (PubChem CID 142673580) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl N-ethyl-N-[3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate.
| Compound Name | methyl N-ethyl-N-[3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 142673580 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | methyl N-ethyl-N-[3-hydroxy-3-[2-(3-methylphenyl)ethynyl]cyclohexyl]carbamate |
| SMILES | CCN(C(=O)OC)C1CCCC(O)(C#Cc2cccc(C)c2)C1 |
| InChI | InChI=1S/C19H25NO3/c1-4-20(18(21)23-3)17-9-6-11-19(22,14-17)12-10-16-8-5-7-15(2)13-16/h5,7-8,13,17,22H,4,6,9,11,14H2,1-3H3 |
| InChIKey | CBZMCAWNMYQEAV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|