C16H32N2O2 — CID 142673930
(2S)-2-[ethoxy(2-methylhex-4-en-3-yl)amino]-N,3,3-trimethylbutanamide (PubChem CID 142673930) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is (2S)-2-[ethoxy(2-methylhex-4-en-3-yl)amino]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[ethoxy(2-methylhex-4-en-3-yl)amino]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 142673930 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | (2S)-2-[ethoxy(2-methylhex-4-en-3-yl)amino]-N,3,3-trimethylbutanamide |
| SMILES | CC=CC(C(C)C)N(OCC)[C@H](C(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-9-11-13(12(3)4)18(20-10-2)14(15(19)17-8)16(5,6)7/h9,11-14H,10H2,1-8H3,(H,17,19)/t13?,14-/m1/s1 |
| InChIKey | YEAZRWOYOXBWPC-ARLHGKGLSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|