piperidin-3-yloxyboronic acid

C5H12BNO3 — CID 142674048

IUPACpiperidin-3-yloxyboronic acid
SMILESOB(O)OC1CCCNC1
InChIInChI=1S/C5H12BNO3/c8-6(9)10-5-2-1-3-7-4-5/h5,7-9H,1-4H2
InChIKeyDJBOCFAHSIMUKH-UHFFFAOYSA-N
MW144.97 g/mol
LogP-1.28
Rot. Bonds2

About piperidin-3-yloxyboronic acid

piperidin-3-yloxyboronic acid (PubChem CID 142674048) has the molecular formula C5H12BNO3 and a molecular weight of 144.97 g/mol. Its IUPAC name is piperidin-3-yloxyboronic acid.

Molecular Properties

Compound Namepiperidin-3-yloxyboronic acid
PubChem CID142674048
Molecular FormulaC5H12BNO3
Molecular Weight144.97 g/mol
Exact Mass145.09
IUPAC Namepiperidin-3-yloxyboronic acid
SMILESOB(O)OC1CCCNC1
InChIInChI=1S/C5H12BNO3/c8-6(9)10-5-2-1-3-7-4-5/h5,7-9H,1-4H2
InChIKeyDJBOCFAHSIMUKH-UHFFFAOYSA-N
XLogP-1.28
TPSA61.72 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.97
LogP ≤ 5-1.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze piperidin-3-yloxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidin-3-yloxyboronic acid?
The IUPAC name of piperidin-3-yloxyboronic acid (CID 142674048) is piperidin-3-yloxyboronic acid.
What is the SMILES notation for piperidin-3-yloxyboronic acid?
The canonical SMILES for piperidin-3-yloxyboronic acid is OB(O)OC1CCCNC1.
What is the InChIKey of piperidin-3-yloxyboronic acid?
The InChIKey is DJBOCFAHSIMUKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12BNO3/c8-6(9)10-5-2-1-3-7-4-5/h5,7-9H,1-4H2.
What are the key properties of piperidin-3-yloxyboronic acid?
piperidin-3-yloxyboronic acid has a molecular weight of 144.97 g/mol, XLogP of -1.28, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-yloxyboronic acid is sourced from PubChem (CID 142674048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).