About piperidin-3-yloxyboronic acid
piperidin-3-yloxyboronic acid (PubChem CID 142674048) has the molecular formula C5H12BNO3
and a molecular weight of 144.97 g/mol. Its IUPAC name is piperidin-3-yloxyboronic acid.
Molecular Properties
| Compound Name | piperidin-3-yloxyboronic acid |
| PubChem CID | 142674048 |
| Molecular Formula | C5H12BNO3 |
| Molecular Weight | 144.97 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | piperidin-3-yloxyboronic acid |
| SMILES | OB(O)OC1CCCNC1 |
| InChI | InChI=1S/C5H12BNO3/c8-6(9)10-5-2-1-3-7-4-5/h5,7-9H,1-4H2 |
| InChIKey | DJBOCFAHSIMUKH-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.97 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze piperidin-3-yloxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-yloxyboronic acid?
The IUPAC name of piperidin-3-yloxyboronic acid (CID 142674048) is piperidin-3-yloxyboronic acid.
What is the SMILES notation for piperidin-3-yloxyboronic acid?
The canonical SMILES for piperidin-3-yloxyboronic acid is OB(O)OC1CCCNC1.
What is the InChIKey of piperidin-3-yloxyboronic acid?
The InChIKey is DJBOCFAHSIMUKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12BNO3/c8-6(9)10-5-2-1-3-7-4-5/h5,7-9H,1-4H2.
What are the key properties of piperidin-3-yloxyboronic acid?
piperidin-3-yloxyboronic acid has a molecular weight of 144.97 g/mol, XLogP of -1.28, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-yloxyboronic acid is sourced from PubChem (CID 142674048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).